C46H36Cl2N4P2 — CID 139169622
N,N-bis(diphenylphosphanyl)-4-(2,6-dipyridin-2-yl-4-pyridinyl)aniline;dichloromethane (PubChem CID 139169622) has the molecular formula C46H36Cl2N4P2 and a molecular weight of 777.68 g/mol. Its IUPAC name is N,N-bis(diphenylphosphanyl)-4-(2,6-dipyridin-2-yl-4-pyridinyl)aniline;dichloromethane.
| Compound Name | N,N-bis(diphenylphosphanyl)-4-(2,6-dipyridin-2-yl-4-pyridinyl)aniline;dichloromethane |
|---|---|
| PubChem CID | 139169622 |
| Molecular Formula | C46H36Cl2N4P2 |
| Molecular Weight | 777.68 g/mol |
| Exact Mass | 776.18 |
| IUPAC Name | N,N-bis(diphenylphosphanyl)-4-(2,6-dipyridin-2-yl-4-pyridinyl)aniline;dichloromethane |
| SMILES | ClCCl.c1ccc(P(c2ccccc2)N(c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C45H34N4P2.CH2Cl2/c1-5-17-38(18-6-1)50(39-19-7-2-8-20-39)49(51(40-21-9-3-10-22-40)41-23-11-4-12-24-41)37-29-27-35(28-30-37)36-33-44(42-25-13-15-31-46-42)48-45(34-36)43-26-14-16-32-47-43;2-1-3/h1-34H;1H2 |
| InChIKey | KQOGONUNANPFAW-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.68 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|