C30H27BCuF4N4OP — CID 139175396
copper(1+);2-methyl-6-[6-[[[6-(6-methyl-2-pyridinyl)-2-pyridinyl]methyl-phenylphosphoryl]methyl]-2-pyridinyl]pyridine;tetrafluoroborate (PubChem CID 139175396) has the molecular formula C30H27BCuF4N4OP and a molecular weight of 640.90 g/mol. Its IUPAC name is copper(1+);2-methyl-6-[6-[[[6-(6-methyl-2-pyridinyl)-2-pyridinyl]methyl-phenylphosphoryl]methyl]-2-pyridinyl]pyridine;tetrafluoroborate.
| Compound Name | copper(1+);2-methyl-6-[6-[[[6-(6-methyl-2-pyridinyl)-2-pyridinyl]methyl-phenylphosphoryl]methyl]-2-pyridinyl]pyridine;tetrafluoroborate |
|---|---|
| PubChem CID | 139175396 |
| Molecular Formula | C30H27BCuF4N4OP |
| Molecular Weight | 640.90 g/mol |
| Exact Mass | 640.12 |
| IUPAC Name | copper(1+);2-methyl-6-[6-[[[6-(6-methyl-2-pyridinyl)-2-pyridinyl]methyl-phenylphosphoryl]methyl]-2-pyridinyl]pyridine;tetrafluoroborate |
| SMILES | Cc1cccc(-c2cccc(CP(=O)(Cc3cccc(-c4cccc(C)n4)n3)c3ccccc3)n2)n1.F[B-](F)(F)F.[Cu+] |
| InChI | InChI=1S/C30H27N4OP.BF4.Cu/c1-22-10-6-16-27(31-22)29-18-8-12-24(33-29)20-36(35,26-14-4-3-5-15-26)21-25-13-9-19-30(34-25)28-17-7-11-23(2)32-28;2-1(3,4)5;/h3-19H,20-21H2,1-2H3;;/q;-1;+1 |
| InChIKey | GNKWPZZDLSWQSJ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.90 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|