C35H31BF2N2 — CID 139177321
12,12-difluoro-2,10,14-triphenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),10,14-pentaene (PubChem CID 139177321) has the molecular formula C35H31BF2N2 and a molecular weight of 528.46 g/mol. Its IUPAC name is 12,12-difluoro-2,10,14-triphenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),10,14-pentaene.
| Compound Name | 12,12-difluoro-2,10,14-triphenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),10,14-pentaene |
|---|---|
| PubChem CID | 139177321 |
| Molecular Formula | C35H31BF2N2 |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 12,12-difluoro-2,10,14-triphenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),10,14-pentaene |
| SMILES | F[B-]1(F)n2c(c3c(c2-c2ccccc2)CCCC3)C(c2ccccc2)=C2C3=C(CCCC3)C(c3ccccc3)=[N+]21 |
| InChI | InChI=1S/C35H31BF2N2/c37-36(38)39-32(25-16-6-2-7-17-25)27-20-10-12-22-29(27)34(39)31(24-14-4-1-5-15-24)35-30-23-13-11-21-28(30)33(40(35)36)26-18-8-3-9-19-26/h1-9,14-19H,10-13,20-23H2 |
| InChIKey | OMTLXVHQMGINOP-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|