C36H50N2O4Ti — CID 139177591
bis(2-tert-butyl-4-methyl-6-[[(1R,2R)-2-oxidocyclohexyl]iminomethyl]phenolate);titanium(4+) (PubChem CID 139177591) has the molecular formula C36H50N2O4Ti and a molecular weight of 622.67 g/mol. Its IUPAC name is bis(2-tert-butyl-4-methyl-6-[[(1R,2R)-2-oxidocyclohexyl]iminomethyl]phenolate);titanium(4+).
| Compound Name | bis(2-tert-butyl-4-methyl-6-[[(1R,2R)-2-oxidocyclohexyl]iminomethyl]phenolate);titanium(4+) |
|---|---|
| PubChem CID | 139177591 |
| Molecular Formula | C36H50N2O4Ti |
| Molecular Weight | 622.67 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | bis(2-tert-butyl-4-methyl-6-[[(1R,2R)-2-oxidocyclohexyl]iminomethyl]phenolate);titanium(4+) |
| SMILES | Cc1cc(/C=N/[C@@H]2CCCC[C@H]2[O-])c([O-])c(C(C)(C)C)c1.Cc1cc(/C=N/[C@@H]2CCCC[C@H]2[O-])c([O-])c(C(C)(C)C)c1.[Ti+4] |
| InChI | InChI=1S/2C18H26NO2.Ti/c2*1-12-9-13(17(21)14(10-12)18(2,3)4)11-19-15-7-5-6-8-16(15)20;/h2*9-11,15-16,21H,5-8H2,1-4H3;/q2*-1;+4/p-2/b2*19-11+;/t2*15-,16-;/m11./s1 |
| InChIKey | LFLXGAOMUYGXMA-HMMATJFCSA-L |
| XLogP | 4.91 |
| TPSA | 116.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|