About 2-(4-chlorophenyl)selanylpyridine;molecular iodine
2-(4-chlorophenyl)selanylpyridine;molecular iodine (PubChem CID 139178443) has the molecular formula C11H8ClI2NSe
and a molecular weight of 522.41 g/mol. Its IUPAC name is 2-(4-chlorophenyl)selanylpyridine;molecular iodine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)selanylpyridine;molecular iodine |
| PubChem CID | 139178443 |
| Molecular Formula | C11H8ClI2NSe |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 522.76 |
| IUPAC Name | 2-(4-chlorophenyl)selanylpyridine;molecular iodine |
| SMILES | Clc1ccc([Se]c2ccccn2)cc1.II |
| InChI | InChI=1S/C11H8ClNSe.I2/c12-9-4-6-10(7-5-9)14-11-3-1-2-8-13-11;1-2/h1-8H; |
| InChIKey | RSXMKEFHPHPYMH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)selanylpyridine;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)selanylpyridine;molecular iodine?
The IUPAC name of 2-(4-chlorophenyl)selanylpyridine;molecular iodine (CID 139178443) is 2-(4-chlorophenyl)selanylpyridine;molecular iodine.
What is the SMILES notation for 2-(4-chlorophenyl)selanylpyridine;molecular iodine?
The canonical SMILES for 2-(4-chlorophenyl)selanylpyridine;molecular iodine is Clc1ccc([Se]c2ccccn2)cc1.II.
What is the InChIKey of 2-(4-chlorophenyl)selanylpyridine;molecular iodine?
The InChIKey is RSXMKEFHPHPYMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNSe.I2/c12-9-4-6-10(7-5-9)14-11-3-1-2-8-13-11;1-2/h1-8H;.
What are the key properties of 2-(4-chlorophenyl)selanylpyridine;molecular iodine?
2-(4-chlorophenyl)selanylpyridine;molecular iodine has a molecular weight of 522.41 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)selanylpyridine;molecular iodine is sourced from PubChem (CID 139178443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).