C24H21NO2S — CID 139180441
S-[(2S,3R)-3-methyl-4-oxo-1,2,3-triphenylazetidin-2-yl] ethanethioate (PubChem CID 139180441) has the molecular formula C24H21NO2S and a molecular weight of 387.50 g/mol. Its IUPAC name is S-[(2S,3R)-3-methyl-4-oxo-1,2,3-triphenylazetidin-2-yl] ethanethioate.
| Compound Name | S-[(2S,3R)-3-methyl-4-oxo-1,2,3-triphenylazetidin-2-yl] ethanethioate |
|---|---|
| PubChem CID | 139180441 |
| Molecular Formula | C24H21NO2S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | S-[(2S,3R)-3-methyl-4-oxo-1,2,3-triphenylazetidin-2-yl] ethanethioate |
| SMILES | CC(=O)S[C@]1(c2ccccc2)N(c2ccccc2)C(=O)[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C24H21NO2S/c1-18(26)28-24(20-14-8-4-9-15-20)23(2,19-12-6-3-7-13-19)22(27)25(24)21-16-10-5-11-17-21/h3-17H,1-2H3/t23-,24+/m1/s1 |
| InChIKey | ALTKABYKKFEDJC-RPWUZVMVSA-N |
| XLogP | 5.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|