C44H63N5O3 — CID 139180485
1,3-bis(2,3-dimethyl-1H-indol-7-yl)urea;tetrabutylazanium;benzoate (PubChem CID 139180485) has the molecular formula C44H63N5O3 and a molecular weight of 710.02 g/mol. Its IUPAC name is 1,3-bis(2,3-dimethyl-1H-indol-7-yl)urea;tetrabutylazanium;benzoate.
| Compound Name | 1,3-bis(2,3-dimethyl-1H-indol-7-yl)urea;tetrabutylazanium;benzoate |
|---|---|
| PubChem CID | 139180485 |
| Molecular Formula | C44H63N5O3 |
| Molecular Weight | 710.02 g/mol |
| Exact Mass | 709.49 |
| IUPAC Name | 1,3-bis(2,3-dimethyl-1H-indol-7-yl)urea;tetrabutylazanium;benzoate |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Cc1[nH]c2c(NC(=O)Nc3cccc4c(C)c(C)[nH]c34)cccc2c1C.O=C([O-])c1ccccc1 |
| InChI | InChI=1S/C21H22N4O.C16H36N.C7H6O2/c1-11-13(3)22-19-15(11)7-5-9-17(19)24-21(26)25-18-10-6-8-16-12(2)14(4)23-20(16)18;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-7(9)6-4-2-1-3-5-6/h5-10,22-23H,1-4H3,(H2,24,25,26);5-16H2,1-4H3;1-5H,(H,8,9)/q;+1;/p-1 |
| InChIKey | UFWAQYCHFBEYFH-UHFFFAOYSA-M |
| XLogP | 10.58 |
| TPSA | 112.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.02 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|