C27H38BrCl3N4 — CID 139182018
chloroform;N-[[6-[[3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-1-yl]methyl]-2-pyridinyl]methyl]-N-ethylethanamine;bromide (PubChem CID 139182018) has the molecular formula C27H38BrCl3N4 and a molecular weight of 604.89 g/mol. Its IUPAC name is chloroform;N-[[6-[[3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-1-yl]methyl]-2-pyridinyl]methyl]-N-ethylethanamine;bromide.
| Compound Name | chloroform;N-[[6-[[3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-1-yl]methyl]-2-pyridinyl]methyl]-N-ethylethanamine;bromide |
|---|---|
| PubChem CID | 139182018 |
| Molecular Formula | C27H38BrCl3N4 |
| Molecular Weight | 604.89 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | chloroform;N-[[6-[[3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-1-yl]methyl]-2-pyridinyl]methyl]-N-ethylethanamine;bromide |
| SMILES | CCN(CC)Cc1cccc(C[n+]2ccn(-c3c(C(C)C)cccc3C(C)C)c2)n1.ClC(Cl)Cl.[Br-] |
| InChI | InChI=1S/C26H37N4.CHCl3.BrH/c1-7-28(8-2)17-22-11-9-12-23(27-22)18-29-15-16-30(19-29)26-24(20(3)4)13-10-14-25(26)21(5)6;2-1(3)4;/h9-16,19-21H,7-8,17-18H2,1-6H3;1H;1H/q+1;;/p-1 |
| InChIKey | HUWDXDSJMPUATO-UHFFFAOYSA-M |
| XLogP | 4.29 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|