C30H31N2+ — CID 122382514
1-[2,6-di(propan-2-yl)phenyl]-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)imidazol-3-ium (PubChem CID 122382514) has the molecular formula C30H31N2+ and a molecular weight of 419.59 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)imidazol-3-ium.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)imidazol-3-ium |
|---|---|
| PubChem CID | 122382514 |
| Molecular Formula | C30H31N2+ |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)imidazol-3-ium |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](C2c3ccccc3C=Cc3ccccc32)c1 |
| InChI | InChI=1S/C30H31N2/c1-21(2)25-14-9-15-26(22(3)4)29(25)31-18-19-32(20-31)30-27-12-7-5-10-23(27)16-17-24-11-6-8-13-28(24)30/h5-22,30H,1-4H3/q+1 |
| InChIKey | DMHCVVIAZWVEHH-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|