C29H40ClN3 — CID 162177024
N-[2,6-di(propan-2-yl)phenyl]-1-[3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-1-yl]ethanimine chloride (PubChem CID 162177024) has the molecular formula C29H40ClN3 and a molecular weight of 466.11 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-1-[3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-1-yl]ethanimine chloride.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-1-[3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-1-yl]ethanimine chloride |
|---|---|
| PubChem CID | 162177024 |
| Molecular Formula | C29H40ClN3 |
| Molecular Weight | 466.11 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-1-[3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-1-yl]ethanimine chloride |
| SMILES | C/C(=N\c1c(C(C)C)cccc1C(C)C)[n+]1ccn(-c2c(C(C)C)cccc2C(C)C)c1.[Cl-] |
| InChI | InChI=1S/C29H40N3.ClH/c1-19(2)24-12-10-13-25(20(3)4)28(24)30-23(9)31-16-17-32(18-31)29-26(21(5)6)14-11-15-27(29)22(7)8;/h10-22H,1-9H3;1H/q+1;/p-1/b30-23+; |
| InChIKey | XGDXGTLAXOLALL-LMRTZVMQSA-M |
| XLogP | 4.86 |
| TPSA | 21.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.11 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|