C27H37Br2N2Ni+ — CID 22955368
dibromonickel;N-[2,6-di(propan-2-yl)phenyl]-3-(8-methyl-5-propan-2-yl-7-azoniabicyclo[4.2.0]octa-1(6),2,4-trien-7-ylidene)butan-2-imine (PubChem CID 22955368) has the molecular formula C27H37Br2N2Ni+ and a molecular weight of 608.11 g/mol. Its IUPAC name is dibromonickel;N-[2,6-di(propan-2-yl)phenyl]-3-(8-methyl-5-propan-2-yl-7-azoniabicyclo[4.2.0]octa-1(6),2,4-trien-7-ylidene)butan-2-imine.
| Compound Name | dibromonickel;N-[2,6-di(propan-2-yl)phenyl]-3-(8-methyl-5-propan-2-yl-7-azoniabicyclo[4.2.0]octa-1(6),2,4-trien-7-ylidene)butan-2-imine |
|---|---|
| PubChem CID | 22955368 |
| Molecular Formula | C27H37Br2N2Ni+ |
| Molecular Weight | 608.11 g/mol |
| Exact Mass | 605.07 |
| IUPAC Name | dibromonickel;N-[2,6-di(propan-2-yl)phenyl]-3-(8-methyl-5-propan-2-yl-7-azoniabicyclo[4.2.0]octa-1(6),2,4-trien-7-ylidene)butan-2-imine |
| SMILES | Br[Ni]Br.CC(/C(C)=N/c1c(C(C)C)cccc1C(C)C)=[N+]1/c2c(C(C)C)cccc2C1C |
| InChI | InChI=1S/C27H37N2.2BrH.Ni/c1-16(2)22-12-10-13-23(17(3)4)26(22)28-19(7)20(8)29-21(9)25-15-11-14-24(18(5)6)27(25)29;;;/h10-18,21H,1-9H3;2*1H;/q+1;;;+2/p-2/b28-19+,29-20+;;; |
| InChIKey | ZKHYXSYCKKNIQN-KRAYHYIOSA-L |
| XLogP | 9.72 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.11 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|