C31H34N4OPt — CID 139182373
2,4-ditert-butyl-6-phenylazanidylphenolate;phenyl(pyridin-2-yl)diazene;platinum(2+) (PubChem CID 139182373) has the molecular formula C31H34N4OPt and a molecular weight of 673.72 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-phenylazanidylphenolate;phenyl(pyridin-2-yl)diazene;platinum(2+).
| Compound Name | 2,4-ditert-butyl-6-phenylazanidylphenolate;phenyl(pyridin-2-yl)diazene;platinum(2+) |
|---|---|
| PubChem CID | 139182373 |
| Molecular Formula | C31H34N4OPt |
| Molecular Weight | 673.72 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | 2,4-ditert-butyl-6-phenylazanidylphenolate;phenyl(pyridin-2-yl)diazene;platinum(2+) |
| SMILES | CC(C)(C)c1cc([N-]c2ccccc2)c([O-])c(C(C)(C)C)c1.[Pt+2].c1ccc(/N=N/c2ccccn2)cc1 |
| InChI | InChI=1S/C20H26NO.C11H9N3.Pt/c1-19(2,3)14-12-16(20(4,5)6)18(22)17(13-14)21-15-10-8-7-9-11-15;1-2-6-10(7-3-1)13-14-11-8-4-5-9-12-11;/h7-13,22H,1-6H3;1-9H;/q-1;;+2/p-1/b;14-13+; |
| InChIKey | TUCSAYGFDKVAON-RXDJDOOOSA-M |
| XLogP | 9.19 |
| TPSA | 74.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.72 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|