C22H24Cl2N8O5 — CID 139182832
bis((3E)-1-(3-chlorophenyl)-3-(1-methyl-4-oxoimidazolidin-2-ylidene)urea);hydrate (PubChem CID 139182832) has the molecular formula C22H24Cl2N8O5 and a molecular weight of 551.39 g/mol. Its IUPAC name is bis((3E)-1-(3-chlorophenyl)-3-(1-methyl-4-oxoimidazolidin-2-ylidene)urea);hydrate.
| Compound Name | bis((3E)-1-(3-chlorophenyl)-3-(1-methyl-4-oxoimidazolidin-2-ylidene)urea);hydrate |
|---|---|
| PubChem CID | 139182832 |
| Molecular Formula | C22H24Cl2N8O5 |
| Molecular Weight | 551.39 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | bis((3E)-1-(3-chlorophenyl)-3-(1-methyl-4-oxoimidazolidin-2-ylidene)urea);hydrate |
| SMILES | CN1CC(=O)N/C1=N\C(=O)Nc1cccc(Cl)c1.CN1CC(=O)N/C1=N\C(=O)Nc1cccc(Cl)c1.O |
| InChI | InChI=1S/2C11H11ClN4O2.H2O/c2*1-16-6-9(17)14-10(16)15-11(18)13-8-4-2-3-7(12)5-8;/h2*2-5H,6H2,1H3,(H2,13,14,15,17,18);1H2 |
| InChIKey | YNFUZLHLVJCNFS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 179.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|