C42H37Cl6N5O13 — CID 139183249
chloroform;methyl 3-[[3-[[2-hydroxy-3-[[2-methoxy-3-[(2-methoxy-3-nitrobenzoyl)amino]benzoyl]amino]benzoyl]amino]-2-methoxybenzoyl]amino]-2-methoxybenzoate (PubChem CID 139183249) has the molecular formula C42H37Cl6N5O13 and a molecular weight of 1032.50 g/mol. Its IUPAC name is chloroform;methyl 3-[[3-[[2-hydroxy-3-[[2-methoxy-3-[(2-methoxy-3-nitrobenzoyl)amino]benzoyl]amino]benzoyl]amino]-2-methoxybenzoyl]amino]-2-methoxybenzoate.
| Compound Name | chloroform;methyl 3-[[3-[[2-hydroxy-3-[[2-methoxy-3-[(2-methoxy-3-nitrobenzoyl)amino]benzoyl]amino]benzoyl]amino]-2-methoxybenzoyl]amino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 139183249 |
| Molecular Formula | C42H37Cl6N5O13 |
| Molecular Weight | 1032.50 g/mol |
| Exact Mass | 1029.05 |
| IUPAC Name | chloroform;methyl 3-[[3-[[2-hydroxy-3-[[2-methoxy-3-[(2-methoxy-3-nitrobenzoyl)amino]benzoyl]amino]benzoyl]amino]-2-methoxybenzoyl]amino]-2-methoxybenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cccc(NC(=O)c3cccc(NC(=O)c4cccc(NC(=O)c5cccc([N+](=O)[O-])c5OC)c4OC)c3O)c2OC)c1OC.ClC(Cl)Cl.ClC(Cl)Cl |
| InChI | InChI=1S/C40H35N5O13.2CHCl3/c1-54-32-22(12-7-18-28(32)43-39(50)24-14-10-20-30(45(52)53)35(24)57-4)37(48)41-26-16-6-11-21(31(26)46)36(47)42-27-17-8-13-23(33(27)55-2)38(49)44-29-19-9-15-25(34(29)56-3)40(51)58-5;2*2-1(3)4/h6-20,46H,1-5H3,(H,41,48)(H,42,47)(H,43,50)(H,44,49);2*1H |
| InChIKey | FWTUDWISDHPISZ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 242.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1032.50 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|