C24H19F6NS — CID 139183424
2-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethyl-6-phenylpyridine (PubChem CID 139183424) has the molecular formula C24H19F6NS and a molecular weight of 467.48 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethyl-6-phenylpyridine.
| Compound Name | 2-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethyl-6-phenylpyridine |
|---|---|
| PubChem CID | 139183424 |
| Molecular Formula | C24H19F6NS |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethyl-6-phenylpyridine |
| SMILES | Cc1cc(C2=C(c3nc(-c4ccccc4)c(C)cc3C)C(F)(F)C(F)(F)C2(F)F)c(C)s1 |
| InChI | InChI=1S/C24H19F6NS/c1-12-10-13(2)21(31-20(12)16-8-6-5-7-9-16)19-18(17-11-14(3)32-15(17)4)22(25,26)24(29,30)23(19,27)28/h5-11H,1-4H3 |
| InChIKey | JJCNTQKZFHOTMA-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|