C13H26F3O4PS — CID 139185368
ditert-butyl-[(2S)-oxolan-2-yl]phosphanium;trifluoromethanesulfonate (PubChem CID 139185368) has the molecular formula C13H26F3O4PS and a molecular weight of 366.38 g/mol. Its IUPAC name is ditert-butyl-[(2S)-oxolan-2-yl]phosphanium;trifluoromethanesulfonate.
| Compound Name | ditert-butyl-[(2S)-oxolan-2-yl]phosphanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139185368 |
| Molecular Formula | C13H26F3O4PS |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | ditert-butyl-[(2S)-oxolan-2-yl]phosphanium;trifluoromethanesulfonate |
| SMILES | CC(C)(C)[PH+]([C@H]1CCCO1)C(C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C12H25OP.CHF3O3S/c1-11(2,3)14(12(4,5)6)10-8-7-9-13-10;2-1(3,4)8(5,6)7/h10H,7-9H2,1-6H3;(H,5,6,7)/t10-;/m0./s1 |
| InChIKey | FFZPHWVSBIHHOY-PPHPATTJSA-N |
| XLogP | 3.99 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|