C15H6BrF2N — CID 139186214
4-[2-(4-bromo-2,5-difluorophenyl)ethynyl]benzonitrile (PubChem CID 139186214) has the molecular formula C15H6BrF2N and a molecular weight of 318.12 g/mol. Its IUPAC name is 4-[2-(4-bromo-2,5-difluorophenyl)ethynyl]benzonitrile.
| Compound Name | 4-[2-(4-bromo-2,5-difluorophenyl)ethynyl]benzonitrile |
|---|---|
| PubChem CID | 139186214 |
| Molecular Formula | C15H6BrF2N |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 4-[2-(4-bromo-2,5-difluorophenyl)ethynyl]benzonitrile |
| SMILES | N#Cc1ccc(C#Cc2cc(F)c(Br)cc2F)cc1 |
| InChI | InChI=1S/C15H6BrF2N/c16-13-8-14(17)12(7-15(13)18)6-5-10-1-3-11(9-19)4-2-10/h1-4,7-8H |
| InChIKey | YFBYBIPCNKAISA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|