C42H22F52N2O4 — CID 139187173
tert-butyl 3,4-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrole-1-carboxylate (PubChem CID 139187173) has the molecular formula C42H22F52N2O4 and a molecular weight of 1606.54 g/mol. Its IUPAC name is tert-butyl 3,4-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrole-1-carboxylate.
| Compound Name | tert-butyl 3,4-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 139187173 |
| Molecular Formula | C42H22F52N2O4 |
| Molecular Weight | 1606.54 g/mol |
| Exact Mass | 1606.07 |
| IUPAC Name | tert-butyl 3,4-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1.CC(C)(C)OC(=O)n1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/2C21H11F26NO2/c2*1-9(2,3)50-8(49)48-4-6(10(22,23)12(26,27)14(30,31)16(34,35)18(38,39)20(42,43)44)7(5-48)11(24,25)13(28,29)15(32,33)17(36,37)19(40,41)21(45,46)47/h2*4-5H,1-3H3 |
| InChIKey | QNXYTTYBUYUISQ-UHFFFAOYSA-N |
| XLogP | 21.32 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 100 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1606.54 |
| LogP ≤ 5 | 21.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|