C13H17NO3 — CID 10879087
tert-butyl 5-hydroxy-4,5-dihydroisoindole-2-carboxylate (PubChem CID 10879087) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is tert-butyl 5-hydroxy-4,5-dihydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 5-hydroxy-4,5-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 10879087 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | tert-butyl 5-hydroxy-4,5-dihydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc2c(c1)CC(O)C=C2 |
| InChI | InChI=1S/C13H17NO3/c1-13(2,3)17-12(16)14-7-9-4-5-11(15)6-10(9)8-14/h4-5,7-8,11,15H,6H2,1-3H3 |
| InChIKey | XTYZCQJWFRKEJV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |