C30H40Br2N2O8 — CID 139188459
tert-butyl (2R,3R)-3-(4-bromophenyl)-2-formamido-3-hydroxybutanoate (PubChem CID 139188459) has the molecular formula C30H40Br2N2O8 and a molecular weight of 716.46 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-(4-bromophenyl)-2-formamido-3-hydroxybutanoate.
| Compound Name | tert-butyl (2R,3R)-3-(4-bromophenyl)-2-formamido-3-hydroxybutanoate |
|---|---|
| PubChem CID | 139188459 |
| Molecular Formula | C30H40Br2N2O8 |
| Molecular Weight | 716.46 g/mol |
| Exact Mass | 714.12 |
| IUPAC Name | tert-butyl (2R,3R)-3-(4-bromophenyl)-2-formamido-3-hydroxybutanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](NC=O)[C@](C)(O)c1ccc(Br)cc1.CC(C)(C)OC(=O)[C@H](NC=O)[C@](C)(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/2C15H20BrNO4/c2*1-14(2,3)21-13(19)12(17-9-18)15(4,20)10-5-7-11(16)8-6-10/h2*5-9,12,20H,1-4H3,(H,17,18)/t2*12-,15+/m00/s1 |
| InChIKey | WKGWQCWITAAUGI-WLNAYVIXSA-N |
| XLogP | 4.23 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|