C13H27NO3 — CID 143783019
tert-butyl (2S)-2-formamido-3,3-dimethylbutanoate;ethane (PubChem CID 143783019) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is tert-butyl (2S)-2-formamido-3,3-dimethylbutanoate;ethane.
| Compound Name | tert-butyl (2S)-2-formamido-3,3-dimethylbutanoate;ethane |
|---|---|
| PubChem CID | 143783019 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | tert-butyl (2S)-2-formamido-3,3-dimethylbutanoate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)[C@@H](NC=O)C(C)(C)C |
| InChI | InChI=1S/C11H21NO3.C2H6/c1-10(2,3)8(12-7-13)9(14)15-11(4,5)6;1-2/h7-8H,1-6H3,(H,12,13);1-2H3/t8-;/m1./s1 |
| InChIKey | PZDWWGRXXMMZLI-DDWIOCJRSA-N |
| XLogP | 2.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|