C44H37BF2N2 — CID 139188917
4,12-dibenzhydryl-2,2-difluoro-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139188917) has the molecular formula C44H37BF2N2 and a molecular weight of 642.60 g/mol. Its IUPAC name is 4,12-dibenzhydryl-2,2-difluoro-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 4,12-dibenzhydryl-2,2-difluoro-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139188917 |
| Molecular Formula | C44H37BF2N2 |
| Molecular Weight | 642.60 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 4,12-dibenzhydryl-2,2-difluoro-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | Cc1cc(C)c(C2=C3C=CC(C(c4ccccc4)c4ccccc4)=[N+]3[B-](F)(F)n3c2ccc3C(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C44H37BF2N2/c1-30-28-31(2)41(32(3)29-30)44-39-26-24-37(42(33-16-8-4-9-17-33)34-18-10-5-11-19-34)48(39)45(46,47)49-38(25-27-40(44)49)43(35-20-12-6-13-21-35)36-22-14-7-15-23-36/h4-29,42-43H,1-3H3 |
| InChIKey | JNZFXEXMKTZKKL-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.60 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|