C16H29IN2 — CID 139189447
(1S,2R,7R,9S,17S)-7-methyl-13-aza-7-azoniatetracyclo[7.7.1.02,7.013,17]heptadecane iodide (PubChem CID 139189447) has the molecular formula C16H29IN2 and a molecular weight of 376.33 g/mol. Its IUPAC name is (1S,2R,7R,9S,17S)-7-methyl-13-aza-7-azoniatetracyclo[7.7.1.02,7.013,17]heptadecane iodide.
| Compound Name | (1S,2R,7R,9S,17S)-7-methyl-13-aza-7-azoniatetracyclo[7.7.1.02,7.013,17]heptadecane iodide |
|---|---|
| PubChem CID | 139189447 |
| Molecular Formula | C16H29IN2 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (1S,2R,7R,9S,17S)-7-methyl-13-aza-7-azoniatetracyclo[7.7.1.02,7.013,17]heptadecane iodide |
| SMILES | C[N@+]12CCCC[C@@H]1[C@H]1CCCN3CCC[C@@H](C2)[C@@H]13.[I-] |
| InChI | InChI=1S/C16H29N2.HI/c1-18-11-3-2-8-15(18)14-7-5-10-17-9-4-6-13(12-18)16(14)17;/h13-16H,2-12H2,1H3;1H/q+1;/p-1/t13-,14+,15+,16-,18+;/m0./s1 |
| InChIKey | WEDIBCSUPWLNGN-KBSUWBGSSA-M |
| XLogP | -0.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|