C28H50N2O4 — CID 139189970
(2E)-2-(cyclohexylmethylidene)-N-(2-hydroxyethyl)-3-methylbutanamide (PubChem CID 139189970) has the molecular formula C28H50N2O4 and a molecular weight of 478.72 g/mol. Its IUPAC name is (2E)-2-(cyclohexylmethylidene)-N-(2-hydroxyethyl)-3-methylbutanamide.
| Compound Name | (2E)-2-(cyclohexylmethylidene)-N-(2-hydroxyethyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 139189970 |
| Molecular Formula | C28H50N2O4 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.38 |
| IUPAC Name | (2E)-2-(cyclohexylmethylidene)-N-(2-hydroxyethyl)-3-methylbutanamide |
| SMILES | CC(C)/C(=C\C1CCCCC1)C(=O)NCCO.CC(C)/C(=C\C1CCCCC1)C(=O)NCCO |
| InChI | InChI=1S/2C14H25NO2/c2*1-11(2)13(14(17)15-8-9-16)10-12-6-4-3-5-7-12/h2*10-12,16H,3-9H2,1-2H3,(H,15,17)/b2*13-10+ |
| InChIKey | YYVDRIIJKIUUTG-GJQXIAOISA-N |
| XLogP | 4.52 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|