C15H27NO2 — CID 11357237
(2E,5S)-N-(2-hydroxyethyl)-2,5,9-trimethyldeca-2,8-dienamide (PubChem CID 11357237) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (2E,5S)-N-(2-hydroxyethyl)-2,5,9-trimethyldeca-2,8-dienamide.
| Compound Name | (2E,5S)-N-(2-hydroxyethyl)-2,5,9-trimethyldeca-2,8-dienamide |
|---|---|
| PubChem CID | 11357237 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (2E,5S)-N-(2-hydroxyethyl)-2,5,9-trimethyldeca-2,8-dienamide |
| SMILES | CC(C)=CCC[C@H](C)C/C=C(\C)C(=O)NCCO |
| InChI | InChI=1S/C15H27NO2/c1-12(2)6-5-7-13(3)8-9-14(4)15(18)16-10-11-17/h6,9,13,17H,5,7-8,10-11H2,1-4H3,(H,16,18)/b14-9+/t13-/m0/s1 |
| InChIKey | URBIJLIVEOCBDK-FYQHACEVSA-N |
| XLogP | 2.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|