C16H28N2O2 — CID 130380848
(E)-2,5-dimethyl-N-(2-methylpropyl)-7-(prop-2-enoylamino)hept-2-enamide (PubChem CID 130380848) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is (E)-2,5-dimethyl-N-(2-methylpropyl)-7-(prop-2-enoylamino)hept-2-enamide.
| Compound Name | (E)-2,5-dimethyl-N-(2-methylpropyl)-7-(prop-2-enoylamino)hept-2-enamide |
|---|---|
| PubChem CID | 130380848 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (E)-2,5-dimethyl-N-(2-methylpropyl)-7-(prop-2-enoylamino)hept-2-enamide |
| SMILES | C=CC(=O)NCCC(C)C/C=C(\C)C(=O)NCC(C)C |
| InChI | InChI=1S/C16H28N2O2/c1-6-15(19)17-10-9-13(4)7-8-14(5)16(20)18-11-12(2)3/h6,8,12-13H,1,7,9-11H2,2-5H3,(H,17,19)(H,18,20)/b14-8+ |
| InChIKey | YPVITSXWOHUMNH-RIYZIHGNSA-N |
| XLogP | 2.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|