C17H32N4O3 — CID 139190267
(2S)-1-(2,2-dimethylpropanoyl)-N-[(1R)-3-methyl-1-(methylcarbamoylamino)butyl]pyrrolidine-2-carboxamide (PubChem CID 139190267) has the molecular formula C17H32N4O3 and a molecular weight of 340.47 g/mol. Its IUPAC name is (2S)-1-(2,2-dimethylpropanoyl)-N-[(1R)-3-methyl-1-(methylcarbamoylamino)butyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(2,2-dimethylpropanoyl)-N-[(1R)-3-methyl-1-(methylcarbamoylamino)butyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 139190267 |
| Molecular Formula | C17H32N4O3 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | (2S)-1-(2,2-dimethylpropanoyl)-N-[(1R)-3-methyl-1-(methylcarbamoylamino)butyl]pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)N[C@H](CC(C)C)NC(=O)[C@@H]1CCCN1C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H32N4O3/c1-11(2)10-13(20-16(24)18-6)19-14(22)12-8-7-9-21(12)15(23)17(3,4)5/h11-13H,7-10H2,1-6H3,(H,19,22)(H2,18,20,24)/t12-,13+/m0/s1 |
| InChIKey | JYKCGGBCFAIWTR-QWHCGFSZSA-N |
| XLogP | 1.44 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|