C16H29NO3 — CID 91721433
4-methylpentyl 1-(2,2-dimethylpropanoyl)pyrrolidine-2-carboxylate (PubChem CID 91721433) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is 4-methylpentyl 1-(2,2-dimethylpropanoyl)pyrrolidine-2-carboxylate.
| Compound Name | 4-methylpentyl 1-(2,2-dimethylpropanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91721433 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 4-methylpentyl 1-(2,2-dimethylpropanoyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)CCCOC(=O)C1CCCN1C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H29NO3/c1-12(2)8-7-11-20-14(18)13-9-6-10-17(13)15(19)16(3,4)5/h12-13H,6-11H2,1-5H3 |
| InChIKey | KZQVBYIOOGOOQR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|