C62H54N2O2 — CID 139190461
(2S,4S)-2-anthracen-9-yl-3,4-dibenzyl-1,3-oxazolidine (PubChem CID 139190461) has the molecular formula C62H54N2O2 and a molecular weight of 859.13 g/mol. Its IUPAC name is (2S,4S)-2-anthracen-9-yl-3,4-dibenzyl-1,3-oxazolidine.
| Compound Name | (2S,4S)-2-anthracen-9-yl-3,4-dibenzyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 139190461 |
| Molecular Formula | C62H54N2O2 |
| Molecular Weight | 859.13 g/mol |
| Exact Mass | 858.42 |
| IUPAC Name | (2S,4S)-2-anthracen-9-yl-3,4-dibenzyl-1,3-oxazolidine |
| SMILES | c1ccc(C[C@H]2CO[C@@H](c3c4ccccc4cc4ccccc34)N2Cc2ccccc2)cc1.c1ccc(C[C@H]2CO[C@@H](c3c4ccccc4cc4ccccc34)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/2C31H27NO/c2*1-3-11-23(12-4-1)19-27-22-33-31(32(27)21-24-13-5-2-6-14-24)30-28-17-9-7-15-25(28)20-26-16-8-10-18-29(26)30/h2*1-18,20,27,31H,19,21-22H2/t2*27-,31-/m00/s1 |
| InChIKey | CNHBRTQANPEAIJ-LPLVGDFFSA-N |
| XLogP | 14.27 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.13 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|