C28H26Cl2N4O4 — CID 139191095
ethyl 2-amino-6-(4-chlorophenyl)pyridine-3-carboxylate (PubChem CID 139191095) has the molecular formula C28H26Cl2N4O4 and a molecular weight of 553.45 g/mol. Its IUPAC name is ethyl 2-amino-6-(4-chlorophenyl)pyridine-3-carboxylate.
| Compound Name | ethyl 2-amino-6-(4-chlorophenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139191095 |
| Molecular Formula | C28H26Cl2N4O4 |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | ethyl 2-amino-6-(4-chlorophenyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(Cl)cc2)nc1N.CCOC(=O)c1ccc(-c2ccc(Cl)cc2)nc1N |
| InChI | InChI=1S/2C14H13ClN2O2/c2*1-2-19-14(18)11-7-8-12(17-13(11)16)9-3-5-10(15)6-4-9/h2*3-8H,2H2,1H3,(H2,16,17) |
| InChIKey | YOWZZIKALNYGSC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |