C11H12F3NO2 — CID 139191316
2,2,2-trifluoro-N-[(1S)-2-methoxy-1-phenylethyl]ethanimine oxide (PubChem CID 139191316) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1S)-2-methoxy-1-phenylethyl]ethanimine oxide.
| Compound Name | 2,2,2-trifluoro-N-[(1S)-2-methoxy-1-phenylethyl]ethanimine oxide |
|---|---|
| PubChem CID | 139191316 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1S)-2-methoxy-1-phenylethyl]ethanimine oxide |
| SMILES | COC[C@H](c1ccccc1)/[N+]([O-])=C/C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO2/c1-17-7-10(9-5-3-2-4-6-9)15(16)8-11(12,13)14/h2-6,8,10H,7H2,1H3/b15-8-/t10-/m1/s1 |
| InChIKey | CWVRVKPYWYBXGP-IIBSKXHVSA-N |
| XLogP | 2.52 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|