About acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate
acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate (PubChem CID 139191351) has the molecular formula C23H15IN2O4
and a molecular weight of 510.29 g/mol. Its IUPAC name is acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate.
Molecular Properties
| Compound Name | acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate |
| PubChem CID | 139191351 |
| Molecular Formula | C23H15IN2O4 |
| Molecular Weight | 510.29 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate |
| SMILES | CC#N.COC(=O)c1ccccc1-c1c(I)cnc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H12INO4.C2H3N/c1-27-21(26)14-9-5-2-6-11(14)16-15(22)10-23-18-17(16)19(24)12-7-3-4-8-13(12)20(18)25;1-2-3/h2-10H,1H3;1H3 |
| InChIKey | VQJXNVSKHIILIN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 97.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 510.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate?
The IUPAC name of acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate (CID 139191351) is acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate.
What is the SMILES notation for acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate?
The canonical SMILES for acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate is CC#N.COC(=O)c1ccccc1-c1c(I)cnc2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate?
The InChIKey is VQJXNVSKHIILIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12INO4.C2H3N/c1-27-21(26)14-9-5-2-6-11(14)16-15(22)10-23-18-17(16)19(24)12-7-3-4-8-13(12)20(18)25;1-2-3/h2-10H,1H3;1H3.
What are the key properties of acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate?
acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate has a molecular weight of 510.29 g/mol, XLogP of 4.45, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;methyl 2-(3-iodo-5,10-dioxobenzo[g]quinolin-4-yl)benzoate is sourced from PubChem (CID 139191351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).