C17H11NO6 — CID 11723816
dimethyl 5,6-dioxobenzo[f]quinoline-1,3-dicarboxylate (PubChem CID 11723816) has the molecular formula C17H11NO6 and a molecular weight of 325.28 g/mol. Its IUPAC name is dimethyl 5,6-dioxobenzo[f]quinoline-1,3-dicarboxylate.
| Compound Name | dimethyl 5,6-dioxobenzo[f]quinoline-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11723816 |
| Molecular Formula | C17H11NO6 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | dimethyl 5,6-dioxobenzo[f]quinoline-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)c2c(n1)C(=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C17H11NO6/c1-23-16(21)10-7-11(17(22)24-2)18-13-12(10)8-5-3-4-6-9(8)14(19)15(13)20/h3-7H,1-2H3 |
| InChIKey | LNIMNSLDRAQUOP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|