C18H14N2O8 — CID 11760834
8-O-ethyl 2-O,4-O-dimethyl 5,6-dioxo-7H-pyrrolo[2,3-h]quinoline-2,4,8-tricarboxylate (PubChem CID 11760834) has the molecular formula C18H14N2O8 and a molecular weight of 386.32 g/mol. Its IUPAC name is 8-O-ethyl 2-O,4-O-dimethyl 5,6-dioxo-7H-pyrrolo[2,3-h]quinoline-2,4,8-tricarboxylate.
| Compound Name | 8-O-ethyl 2-O,4-O-dimethyl 5,6-dioxo-7H-pyrrolo[2,3-h]quinoline-2,4,8-tricarboxylate |
|---|---|
| PubChem CID | 11760834 |
| Molecular Formula | C18H14N2O8 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 8-O-ethyl 2-O,4-O-dimethyl 5,6-dioxo-7H-pyrrolo[2,3-h]quinoline-2,4,8-tricarboxylate |
| SMILES | CCOC(=O)c1cc2c([nH]1)C(=O)C(=O)c1c(C(=O)OC)cc(C(=O)OC)nc1-2 |
| InChI | InChI=1S/C18H14N2O8/c1-4-28-18(25)10-6-8-12-11(14(21)15(22)13(8)20-10)7(16(23)26-2)5-9(19-12)17(24)27-3/h5-6,20H,4H2,1-3H3 |
| InChIKey | ZHDKCHJHQYLIRW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 141.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|