C15H20N2O4 — CID 70398310
ethyl 4-methyl-1H-pyrrole-3-carboxylate;methyl 4-methyl-1H-pyrrole-3-carboxylate (PubChem CID 70398310) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is ethyl 4-methyl-1H-pyrrole-3-carboxylate;methyl 4-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-methyl-1H-pyrrole-3-carboxylate;methyl 4-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 70398310 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethyl 4-methyl-1H-pyrrole-3-carboxylate;methyl 4-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]cc1C.COC(=O)c1c[nH]cc1C |
| InChI | InChI=1S/C8H11NO2.C7H9NO2/c1-3-11-8(10)7-5-9-4-6(7)2;1-5-3-8-4-6(5)7(9)10-2/h4-5,9H,3H2,1-2H3;3-4,8H,1-2H3 |
| InChIKey | LAHKHYVUMANFMO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |