C34H32N4O4S2 — CID 139191898
methyl 2-[(4R)-3-phenyl-2-sulfanylidene-1,4-dihydroquinazolin-4-yl]acetate (PubChem CID 139191898) has the molecular formula C34H32N4O4S2 and a molecular weight of 624.79 g/mol. Its IUPAC name is methyl 2-[(4R)-3-phenyl-2-sulfanylidene-1,4-dihydroquinazolin-4-yl]acetate.
| Compound Name | methyl 2-[(4R)-3-phenyl-2-sulfanylidene-1,4-dihydroquinazolin-4-yl]acetate |
|---|---|
| PubChem CID | 139191898 |
| Molecular Formula | C34H32N4O4S2 |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | methyl 2-[(4R)-3-phenyl-2-sulfanylidene-1,4-dihydroquinazolin-4-yl]acetate |
| SMILES | COC(=O)C[C@@H]1c2ccccc2NC(=S)N1c1ccccc1.COC(=O)C[C@@H]1c2ccccc2NC(=S)N1c1ccccc1 |
| InChI | InChI=1S/2C17H16N2O2S/c2*1-21-16(20)11-15-13-9-5-6-10-14(13)18-17(22)19(15)12-7-3-2-4-8-12/h2*2-10,15H,11H2,1H3,(H,18,22)/t2*15-/m11/s1 |
| InChIKey | ZKUCWNKCMYJUJU-PZYGRECOSA-N |
| XLogP | 7.02 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|