C20H21N3O4S — CID 139225000
butyl 2-[3-(4-nitrophenyl)-2-sulfanylidene-1,4-dihydroquinazolin-4-yl]acetate (PubChem CID 139225000) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is butyl 2-[3-(4-nitrophenyl)-2-sulfanylidene-1,4-dihydroquinazolin-4-yl]acetate.
| Compound Name | butyl 2-[3-(4-nitrophenyl)-2-sulfanylidene-1,4-dihydroquinazolin-4-yl]acetate |
|---|---|
| PubChem CID | 139225000 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | butyl 2-[3-(4-nitrophenyl)-2-sulfanylidene-1,4-dihydroquinazolin-4-yl]acetate |
| SMILES | CCCCOC(=O)CC1c2ccccc2NC(=S)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-2-3-12-27-19(24)13-18-16-6-4-5-7-17(16)21-20(28)22(18)14-8-10-15(11-9-14)23(25)26/h4-11,18H,2-3,12-13H2,1H3,(H,21,28) |
| InChIKey | NLHXVEPLKOABFB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|