C20H28N2O2S — CID 139225001
butyl 2-(3-cyclohexyl-2-sulfanylidene-1,4-dihydroquinazolin-4-yl)acetate (PubChem CID 139225001) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is butyl 2-(3-cyclohexyl-2-sulfanylidene-1,4-dihydroquinazolin-4-yl)acetate.
| Compound Name | butyl 2-(3-cyclohexyl-2-sulfanylidene-1,4-dihydroquinazolin-4-yl)acetate |
|---|---|
| PubChem CID | 139225001 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | butyl 2-(3-cyclohexyl-2-sulfanylidene-1,4-dihydroquinazolin-4-yl)acetate |
| SMILES | CCCCOC(=O)CC1c2ccccc2NC(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C20H28N2O2S/c1-2-3-13-24-19(23)14-18-16-11-7-8-12-17(16)21-20(25)22(18)15-9-5-4-6-10-15/h7-8,11-12,15,18H,2-6,9-10,13-14H2,1H3,(H,21,25) |
| InChIKey | KDAWNUWWLYYNIX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|