C20H20ClFN2O2S — CID 139225013
butyl 2-[6-chloro-3-(4-fluorophenyl)-2-sulfanylidene-1,4-dihydroquinazolin-4-yl]acetate (PubChem CID 139225013) has the molecular formula C20H20ClFN2O2S and a molecular weight of 406.91 g/mol. Its IUPAC name is butyl 2-[6-chloro-3-(4-fluorophenyl)-2-sulfanylidene-1,4-dihydroquinazolin-4-yl]acetate.
| Compound Name | butyl 2-[6-chloro-3-(4-fluorophenyl)-2-sulfanylidene-1,4-dihydroquinazolin-4-yl]acetate |
|---|---|
| PubChem CID | 139225013 |
| Molecular Formula | C20H20ClFN2O2S |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | butyl 2-[6-chloro-3-(4-fluorophenyl)-2-sulfanylidene-1,4-dihydroquinazolin-4-yl]acetate |
| SMILES | CCCCOC(=O)CC1c2cc(Cl)ccc2NC(=S)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20ClFN2O2S/c1-2-3-10-26-19(25)12-18-16-11-13(21)4-9-17(16)23-20(27)24(18)15-7-5-14(22)6-8-15/h4-9,11,18H,2-3,10,12H2,1H3,(H,23,27) |
| InChIKey | HITGEKDONZCZEQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|