C20H21ClN2O2S — CID 139225010
butyl 2-(6-chloro-3-phenyl-2-sulfanylidene-1,4-dihydroquinazolin-4-yl)acetate (PubChem CID 139225010) has the molecular formula C20H21ClN2O2S and a molecular weight of 388.92 g/mol. Its IUPAC name is butyl 2-(6-chloro-3-phenyl-2-sulfanylidene-1,4-dihydroquinazolin-4-yl)acetate.
| Compound Name | butyl 2-(6-chloro-3-phenyl-2-sulfanylidene-1,4-dihydroquinazolin-4-yl)acetate |
|---|---|
| PubChem CID | 139225010 |
| Molecular Formula | C20H21ClN2O2S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | butyl 2-(6-chloro-3-phenyl-2-sulfanylidene-1,4-dihydroquinazolin-4-yl)acetate |
| SMILES | CCCCOC(=O)CC1c2cc(Cl)ccc2NC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C20H21ClN2O2S/c1-2-3-11-25-19(24)13-18-16-12-14(21)9-10-17(16)22-20(26)23(18)15-7-5-4-6-8-15/h4-10,12,18H,2-3,11,13H2,1H3,(H,22,26) |
| InChIKey | PCLHDNMFIFMPLL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|