C17H27N5O5S3 — CID 139192412
(3aR,6aS)-N,N-diethyl-6a-(4-methoxyphenyl)-3a-[(R)-methylsulfinyl]-4,4-dioxo-3H-[1,2]thiazolo[4,5-d]triazol-6-amine;methylsulfinylmethane (PubChem CID 139192412) has the molecular formula C17H27N5O5S3 and a molecular weight of 477.63 g/mol. Its IUPAC name is (3aR,6aS)-N,N-diethyl-6a-(4-methoxyphenyl)-3a-[(R)-methylsulfinyl]-4,4-dioxo-3H-[1,2]thiazolo[4,5-d]triazol-6-amine;methylsulfinylmethane.
| Compound Name | (3aR,6aS)-N,N-diethyl-6a-(4-methoxyphenyl)-3a-[(R)-methylsulfinyl]-4,4-dioxo-3H-[1,2]thiazolo[4,5-d]triazol-6-amine;methylsulfinylmethane |
|---|---|
| PubChem CID | 139192412 |
| Molecular Formula | C17H27N5O5S3 |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | (3aR,6aS)-N,N-diethyl-6a-(4-methoxyphenyl)-3a-[(R)-methylsulfinyl]-4,4-dioxo-3H-[1,2]thiazolo[4,5-d]triazol-6-amine;methylsulfinylmethane |
| SMILES | CCN(CC)C1=NS(=O)(=O)[C@@]2([S@@](C)=O)NN=N[C@@]12c1ccc(OC)cc1.CS(C)=O |
| InChI | InChI=1S/C15H21N5O4S2.C2H6OS/c1-5-20(6-2)13-14(11-7-9-12(24-3)10-8-11)15(25(4)21,18-19-17-14)26(22,23)16-13;1-4(2)3/h7-10H,5-6H2,1-4H3,(H,17,18);1-2H3/t14-,15+,25+;/m0./s1 |
| InChIKey | KOMPZSXVBYFBIR-CHGHDBNBSA-N |
| XLogP | 0.97 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |