C21H18N2O3S — CID 134953855
(3R)-3-(4-methoxyphenyl)-3,4-diphenyl-2H-1,2,5-thiadiazole 1,1-dioxide (PubChem CID 134953855) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is (3R)-3-(4-methoxyphenyl)-3,4-diphenyl-2H-1,2,5-thiadiazole 1,1-dioxide.
| Compound Name | (3R)-3-(4-methoxyphenyl)-3,4-diphenyl-2H-1,2,5-thiadiazole 1,1-dioxide |
|---|---|
| PubChem CID | 134953855 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (3R)-3-(4-methoxyphenyl)-3,4-diphenyl-2H-1,2,5-thiadiazole 1,1-dioxide |
| SMILES | COc1ccc([C@@]2(c3ccccc3)NS(=O)(=O)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18N2O3S/c1-26-19-14-12-18(13-15-19)21(17-10-6-3-7-11-17)20(22-27(24,25)23-21)16-8-4-2-5-9-16/h2-15,23H,1H3/t21-/m1/s1 |
| InChIKey | UKCXVOHPORFHMU-OAQYLSRUSA-N |
| XLogP | 3.28 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |