C23H17F3N2O2 — CID 102153375
(4R)-4-(4-methoxyphenyl)-2-phenyl-4-[4-(trifluoromethyl)phenyl]-1H-imidazol-5-one (PubChem CID 102153375) has the molecular formula C23H17F3N2O2 and a molecular weight of 410.40 g/mol. Its IUPAC name is (4R)-4-(4-methoxyphenyl)-2-phenyl-4-[4-(trifluoromethyl)phenyl]-1H-imidazol-5-one.
| Compound Name | (4R)-4-(4-methoxyphenyl)-2-phenyl-4-[4-(trifluoromethyl)phenyl]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 102153375 |
| Molecular Formula | C23H17F3N2O2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (4R)-4-(4-methoxyphenyl)-2-phenyl-4-[4-(trifluoromethyl)phenyl]-1H-imidazol-5-one |
| SMILES | COc1ccc([C@@]2(c3ccc(C(F)(F)F)cc3)N=C(c3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C23H17F3N2O2/c1-30-19-13-11-17(12-14-19)22(16-7-9-18(10-8-16)23(24,25)26)21(29)27-20(28-22)15-5-3-2-4-6-15/h2-14H,1H3,(H,27,28,29)/t22-/m1/s1 |
| InChIKey | SVNPMMKIKCTONV-JOCHJYFZSA-N |
| XLogP | 4.53 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |