C21H18F3NO3S — CID 162539208
2-[2-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]ethyl]sulfonylpyridine (PubChem CID 162539208) has the molecular formula C21H18F3NO3S and a molecular weight of 421.44 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]ethyl]sulfonylpyridine.
| Compound Name | 2-[2-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]ethyl]sulfonylpyridine |
|---|---|
| PubChem CID | 162539208 |
| Molecular Formula | C21H18F3NO3S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]ethyl]sulfonylpyridine |
| SMILES | COc1ccc(C(CS(=O)(=O)c2ccccn2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H18F3NO3S/c1-28-18-11-7-16(8-12-18)19(14-29(26,27)20-4-2-3-13-25-20)15-5-9-17(10-6-15)21(22,23)24/h2-13,19H,14H2,1H3 |
| InChIKey | OMCHVZULLKPGMB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |