C15H16N2O6 — CID 139192873
(3R,6R,7aR)-6-hydroxy-N-methoxy-N-methyl-5,7-dioxo-3-phenyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide (PubChem CID 139192873) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is (3R,6R,7aR)-6-hydroxy-N-methoxy-N-methyl-5,7-dioxo-3-phenyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide.
| Compound Name | (3R,6R,7aR)-6-hydroxy-N-methoxy-N-methyl-5,7-dioxo-3-phenyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide |
|---|---|
| PubChem CID | 139192873 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (3R,6R,7aR)-6-hydroxy-N-methoxy-N-methyl-5,7-dioxo-3-phenyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide |
| SMILES | CON(C)C(=O)[C@@]1(O)C(=O)[C@H]2CO[C@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C15H16N2O6/c1-16(22-2)13(19)15(21)11(18)10-8-23-12(17(10)14(15)20)9-6-4-3-5-7-9/h3-7,10,12,21H,8H2,1-2H3/t10-,12-,15+/m1/s1 |
| InChIKey | MGYVALVMXKJKLD-HCKVZZMMSA-N |
| XLogP | -0.75 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|