C48H52O16S4 — CID 139192927
ethyl (2E,4E,6E)-7-[2-[(1E,3E,5E)-7-ethoxy-7-oxohepta-1,3,5-trienyl]sulfonylphenyl]sulfonylhepta-2,4,6-trienoate (PubChem CID 139192927) has the molecular formula C48H52O16S4 and a molecular weight of 1013.20 g/mol. Its IUPAC name is ethyl (2E,4E,6E)-7-[2-[(1E,3E,5E)-7-ethoxy-7-oxohepta-1,3,5-trienyl]sulfonylphenyl]sulfonylhepta-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E)-7-[2-[(1E,3E,5E)-7-ethoxy-7-oxohepta-1,3,5-trienyl]sulfonylphenyl]sulfonylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 139192927 |
| Molecular Formula | C48H52O16S4 |
| Molecular Weight | 1013.20 g/mol |
| Exact Mass | 1012.21 |
| IUPAC Name | ethyl (2E,4E,6E)-7-[2-[(1E,3E,5E)-7-ethoxy-7-oxohepta-1,3,5-trienyl]sulfonylphenyl]sulfonylhepta-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C/C=C/C=C/S(=O)(=O)c1ccccc1S(=O)(=O)/C=C/C=C/C=C/C(=O)OCC.CCOC(=O)/C=C/C=C/C=C/S(=O)(=O)c1ccccc1S(=O)(=O)/C=C/C=C/C=C/C(=O)OCC |
| InChI | InChI=1S/2C24H26O8S2/c2*1-3-31-23(25)17-9-5-7-13-19-33(27,28)21-15-11-12-16-22(21)34(29,30)20-14-8-6-10-18-24(26)32-4-2/h2*5-20H,3-4H2,1-2H3/b2*7-5+,8-6+,17-9+,18-10+,19-13+,20-14+ |
| InChIKey | WYCXPMWBFCXCLL-IENJZLOTSA-N |
| XLogP | 7.22 |
| TPSA | 241.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.20 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|