C45H51BN2S — CID 139193126
16,21-ditert-butyl-11,11-diphenyl-3-thia-12-aza-10-azonia-11-boranuidahexacyclo[10.10.1.02,10.04,9.013,18.019,23]tricosa-1(22),2(10),4,6,8,13(18),14,16,19(23),20-decaene;hexane (PubChem CID 139193126) has the molecular formula C45H51BN2S and a molecular weight of 662.80 g/mol. Its IUPAC name is 16,21-ditert-butyl-11,11-diphenyl-3-thia-12-aza-10-azonia-11-boranuidahexacyclo[10.10.1.02,10.04,9.013,18.019,23]tricosa-1(22),2(10),4,6,8,13(18),14,16,19(23),20-decaene;hexane.
| Compound Name | 16,21-ditert-butyl-11,11-diphenyl-3-thia-12-aza-10-azonia-11-boranuidahexacyclo[10.10.1.02,10.04,9.013,18.019,23]tricosa-1(22),2(10),4,6,8,13(18),14,16,19(23),20-decaene;hexane |
|---|---|
| PubChem CID | 139193126 |
| Molecular Formula | C45H51BN2S |
| Molecular Weight | 662.80 g/mol |
| Exact Mass | 662.39 |
| IUPAC Name | 16,21-ditert-butyl-11,11-diphenyl-3-thia-12-aza-10-azonia-11-boranuidahexacyclo[10.10.1.02,10.04,9.013,18.019,23]tricosa-1(22),2(10),4,6,8,13(18),14,16,19(23),20-decaene;hexane |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)cc3c1n2[B-](c1ccccc1)(c1ccccc1)[n+]1c-3sc2ccccc21.CCCCCC |
| InChI | InChI=1S/C39H37BN2S.C6H14/c1-38(2,3)26-21-22-33-30(23-26)31-24-27(39(4,5)6)25-32-36(31)41(33)40(28-15-9-7-10-16-28,29-17-11-8-12-18-29)42-34-19-13-14-20-35(34)43-37(32)42;1-3-5-6-4-2/h7-25H,1-6H3;3-6H2,1-2H3 |
| InChIKey | QOLQSTQQUGQYOJ-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.80 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|