C19H11BF2N4S — CID 139193566
13,13-difluoro-12-naphthalen-1-yl-8-thia-11,12-diaza-1-azonia-13-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10-pentaene-10-carbonitrile (PubChem CID 139193566) has the molecular formula C19H11BF2N4S and a molecular weight of 376.20 g/mol. Its IUPAC name is 13,13-difluoro-12-naphthalen-1-yl-8-thia-11,12-diaza-1-azonia-13-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10-pentaene-10-carbonitrile.
| Compound Name | 13,13-difluoro-12-naphthalen-1-yl-8-thia-11,12-diaza-1-azonia-13-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10-pentaene-10-carbonitrile |
|---|---|
| PubChem CID | 139193566 |
| Molecular Formula | C19H11BF2N4S |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 13,13-difluoro-12-naphthalen-1-yl-8-thia-11,12-diaza-1-azonia-13-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10-pentaene-10-carbonitrile |
| SMILES | N#CC1=NN(c2cccc3ccccc23)[B-](F)(F)[n+]2c1sc1ccccc12 |
| InChI | InChI=1S/C19H11BF2N4S/c21-20(22)25-17-9-3-4-11-18(17)27-19(25)15(12-23)24-26(20)16-10-5-7-13-6-1-2-8-14(13)16/h1-11H |
| InChIKey | VSVWUIPASMSCRH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|