C24H16N5S+ — CID 15646860
2-(3-naphthalen-1-yl-5-phenyltetrazol-2-ium-2-yl)-1,3-benzothiazole (PubChem CID 15646860) has the molecular formula C24H16N5S+ and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-(3-naphthalen-1-yl-5-phenyltetrazol-2-ium-2-yl)-1,3-benzothiazole.
| Compound Name | 2-(3-naphthalen-1-yl-5-phenyltetrazol-2-ium-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 15646860 |
| Molecular Formula | C24H16N5S+ |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-(3-naphthalen-1-yl-5-phenyltetrazol-2-ium-2-yl)-1,3-benzothiazole |
| SMILES | c1ccc(-c2nn(-c3cccc4ccccc34)[n+](-c3nc4ccccc4s3)n2)cc1 |
| InChI | InChI=1S/C24H16N5S/c1-2-10-18(11-3-1)23-26-28(21-15-8-12-17-9-4-5-13-19(17)21)29(27-23)24-25-20-14-6-7-16-22(20)30-24/h1-16H/q+1 |
| InChIKey | RWXIALSTJWGRCY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|