C15H15NO4 — CID 139193593
methyl (1S,2R,5S)-6-benzyl-2-hydroxy-7-oxo-6-azabicyclo[3.2.0]hept-3-ene-5-carboxylate (PubChem CID 139193593) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl (1S,2R,5S)-6-benzyl-2-hydroxy-7-oxo-6-azabicyclo[3.2.0]hept-3-ene-5-carboxylate.
| Compound Name | methyl (1S,2R,5S)-6-benzyl-2-hydroxy-7-oxo-6-azabicyclo[3.2.0]hept-3-ene-5-carboxylate |
|---|---|
| PubChem CID | 139193593 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | methyl (1S,2R,5S)-6-benzyl-2-hydroxy-7-oxo-6-azabicyclo[3.2.0]hept-3-ene-5-carboxylate |
| SMILES | COC(=O)[C@]12C=C[C@@H](O)[C@H]1C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C15H15NO4/c1-20-14(19)15-8-7-11(17)12(15)13(18)16(15)9-10-5-3-2-4-6-10/h2-8,11-12,17H,9H2,1H3/t11-,12+,15+/m1/s1 |
| InChIKey | XIRGOAWNSDRSPD-XUJVJEKNSA-N |
| XLogP | 0.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|